![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | 09_Miscellanea c/ | 2021-10-18 10:39 | - | |
| 09 Miscellanea b Beluszky P_ Nagy B_ N Fodor J/ | 2021-10-18 10:39 | - | |
| 09 Miscellanea a Nagy_Béla/ | 2021-10-18 10:39 | - | |
| 08 Urban society_Sátoraljaujhely_Bagdi Robert_Demeter G/ | 2021-10-18 10:39 | - | |
| 08 Peripheries and development level_Pénzes J/ | 2021-10-18 10:38 | - | |
| 07 Political system Pap J/ | 2021-10-18 10:38 | - | |
| 06 Small scale industry 1892 Szulovszky J/ | 2021-10-18 10:38 | - | |
| 06 Industry Jakobi Ákos/ | 2021-10-18 10:38 | - | |
| 06 Industry 1900-1910 Demeter G/ | 2021-10-18 10:38 | - | |
| 05 Zemplen_Barta J/ | 2021-10-18 10:38 | - | |
| 05 Moson Horvath G K/ | 2021-10-18 10:38 | - | |
| 05 Landuse_incomes 1910 Demeter G/ | 2021-10-18 10:38 | - | |
| 05 Landuse changes Konkoly-Gyuro E és Balazs P/ | 2021-10-18 10:38 | - | |
| 05 Landuse and society 1910 Demeter G/ | 2021-10-18 10:38 | - | |
| 05 Landuse and incomes 1865 1895 Demeter G/ | 2021-10-18 10:38 | - | |
| 05 Agrarian structure Fonagy Z Nagy M/ | 2021-10-18 10:38 | - | |
| 04 Settlement incomes and burdens Demeter G/ | 2021-10-18 10:37 | - | |
| 03 Ethnic structure Demeter G/ | 2021-10-18 10:37 | - | |
| 03 Religion Demeter G/ | 2021-10-18 10:37 | - | |
| 02 Infrastructure_roads_Szalkai G/ | 2021-10-18 10:37 | - | |
| 02 Infrastructure_railways_telegraph_post offices_Frisnyak Zsuzsa_Jakobi A_Demeter G/ | 2021-10-18 10:37 | - | |
| 02 Infrastructure_ Demeter G/ | 2021-10-18 10:37 | - | |
| 01 Demography Health Literacy_Demeter G/ | 2021-10-18 10:37 | - | |
| 00 Foreword/ | 2021-10-18 10:37 | - | |
![[ ]](/icons/unknown.gif) | GISta Hungarorum I.xlsx | 2018-09-12 21:31 | 63K | |
| ~$GISta Hungarorum I.xlsx | 2018-09-12 21:31 | 165 | |
|
|---|